C14H21ClN3O6P — CID 58600249
[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]phosphonic acid (PubChem CID 58600249) has the molecular formula C14H21ClN3O6P and a molecular weight of 393.76 g/mol. Its IUPAC name is [4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]phosphonic acid.
| Compound Name | [4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]phosphonic acid |
|---|---|
| PubChem CID | 58600249 |
| Molecular Formula | C14H21ClN3O6P |
| Molecular Weight | 393.76 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | [4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]phosphonic acid |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NC1CCN(P(=O)(O)O)CC1OC |
| InChI | InChI=1S/C14H21ClN3O6P/c1-23-12-6-10(16)9(15)5-8(12)14(19)17-11-3-4-18(25(20,21)22)7-13(11)24-2/h5-6,11,13H,3-4,7,16H2,1-2H3,(H,17,19)(H2,20,21,22) |
| InChIKey | GKIMUHFBQBYGKY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.76 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|