C18H29ClN3O6P — CID 66624096
[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]-butan-2-yloxyphosphinic acid (PubChem CID 66624096) has the molecular formula C18H29ClN3O6P and a molecular weight of 449.87 g/mol. Its IUPAC name is [4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]-butan-2-yloxyphosphinic acid.
| Compound Name | [4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]-butan-2-yloxyphosphinic acid |
|---|---|
| PubChem CID | 66624096 |
| Molecular Formula | C18H29ClN3O6P |
| Molecular Weight | 449.87 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | [4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]-butan-2-yloxyphosphinic acid |
| SMILES | CCC(C)OP(=O)(O)N1CCC(NC(=O)c2cc(Cl)c(N)cc2OC)C(OC)C1 |
| InChI | InChI=1S/C18H29ClN3O6P/c1-5-11(2)28-29(24,25)22-7-6-15(17(10-22)27-4)21-18(23)12-8-13(19)14(20)9-16(12)26-3/h8-9,11,15,17H,5-7,10,20H2,1-4H3,(H,21,23)(H,24,25) |
| InChIKey | VDZXYHAAWKTHJR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 123.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.87 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|