C12H13BrN2O3S2 — CID 67924942
4-bromo-5-methyl-N-(4-methylphenyl)sulfonyl-5H-1,2-thiazole-2-carboxamide (PubChem CID 67924942) has the molecular formula C12H13BrN2O3S2 and a molecular weight of 377.29 g/mol. Its IUPAC name is 4-bromo-5-methyl-N-(4-methylphenyl)sulfonyl-5H-1,2-thiazole-2-carboxamide.
| Compound Name | 4-bromo-5-methyl-N-(4-methylphenyl)sulfonyl-5H-1,2-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 67924942 |
| Molecular Formula | C12H13BrN2O3S2 |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 375.96 |
| IUPAC Name | 4-bromo-5-methyl-N-(4-methylphenyl)sulfonyl-5H-1,2-thiazole-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)N2C=C(Br)C(C)S2)cc1 |
| InChI | InChI=1S/C12H13BrN2O3S2/c1-8-3-5-10(6-4-8)20(17,18)14-12(16)15-7-11(13)9(2)19-15/h3-7,9H,1-2H3,(H,14,16) |
| InChIKey | VPJSTUTVYNKVMK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|