C30H34FN3O9S — CID 67925705
bis(but-2-enedioic acid);N-[1-[3-(3-fluorophenoxy)propyl]piperidin-4-yl]-3-methyl-1,3-benzothiazol-2-imine (PubChem CID 67925705) has the molecular formula C30H34FN3O9S and a molecular weight of 631.68 g/mol. Its IUPAC name is bis(but-2-enedioic acid);N-[1-[3-(3-fluorophenoxy)propyl]piperidin-4-yl]-3-methyl-1,3-benzothiazol-2-imine.
| Compound Name | bis(but-2-enedioic acid);N-[1-[3-(3-fluorophenoxy)propyl]piperidin-4-yl]-3-methyl-1,3-benzothiazol-2-imine |
|---|---|
| PubChem CID | 67925705 |
| Molecular Formula | C30H34FN3O9S |
| Molecular Weight | 631.68 g/mol |
| Exact Mass | 631.20 |
| IUPAC Name | bis(but-2-enedioic acid);N-[1-[3-(3-fluorophenoxy)propyl]piperidin-4-yl]-3-methyl-1,3-benzothiazol-2-imine |
| SMILES | Cn1/c(=N/C2CCN(CCCOc3cccc(F)c3)CC2)sc2ccccc21.O=C(O)C=CC(=O)O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C22H26FN3OS.2C4H4O4/c1-25-20-8-2-3-9-21(20)28-22(25)24-18-10-13-26(14-11-18)12-5-15-27-19-7-4-6-17(23)16-19;2*5-3(6)1-2-4(7)8/h2-4,6-9,16,18H,5,10-15H2,1H3;2*1-2H,(H,5,6)(H,7,8)/b24-22-;; |
| InChIKey | WZBPBNJRQPZHEZ-PYMCRZDISA-N |
| XLogP | 3.64 |
| TPSA | 178.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.68 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|