C27H32FN3O5S — CID 162330340
(Z)-but-2-enedioic acid;N-[1-[4-(4-fluorophenoxy)butyl]piperidin-4-yl]-3-methyl-1,3-benzothiazol-2-imine (PubChem CID 162330340) has the molecular formula C27H32FN3O5S and a molecular weight of 529.63 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;N-[1-[4-(4-fluorophenoxy)butyl]piperidin-4-yl]-3-methyl-1,3-benzothiazol-2-imine.
| Compound Name | (Z)-but-2-enedioic acid;N-[1-[4-(4-fluorophenoxy)butyl]piperidin-4-yl]-3-methyl-1,3-benzothiazol-2-imine |
|---|---|
| PubChem CID | 162330340 |
| Molecular Formula | C27H32FN3O5S |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | (Z)-but-2-enedioic acid;N-[1-[4-(4-fluorophenoxy)butyl]piperidin-4-yl]-3-methyl-1,3-benzothiazol-2-imine |
| SMILES | Cn1/c(=N/C2CCN(CCCCOc3ccc(F)cc3)CC2)sc2ccccc21.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C23H28FN3OS.C4H4O4/c1-26-21-6-2-3-7-22(21)29-23(26)25-19-12-15-27(16-13-19)14-4-5-17-28-20-10-8-18(24)9-11-20;5-3(6)1-2-4(7)8/h2-3,6-11,19H,4-5,12-17H2,1H3;1-2H,(H,5,6)(H,7,8)/b25-23-;2-1- |
| InChIKey | BQHHSCZKNHOZFP-BDVUFEMKSA-N |
| XLogP | 4.32 |
| TPSA | 104.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|