C22H23N3O3S2 — CID 67927969
N-[[4-(N-phenylanilino)-1,3-thiazol-2-yl]sulfonyl]cyclohexanecarboxamide (PubChem CID 67927969) has the molecular formula C22H23N3O3S2 and a molecular weight of 441.58 g/mol. Its IUPAC name is N-[[4-(N-phenylanilino)-1,3-thiazol-2-yl]sulfonyl]cyclohexanecarboxamide.
| Compound Name | N-[[4-(N-phenylanilino)-1,3-thiazol-2-yl]sulfonyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 67927969 |
| Molecular Formula | C22H23N3O3S2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | N-[[4-(N-phenylanilino)-1,3-thiazol-2-yl]sulfonyl]cyclohexanecarboxamide |
| SMILES | O=C(NS(=O)(=O)c1nc(N(c2ccccc2)c2ccccc2)cs1)C1CCCCC1 |
| InChI | InChI=1S/C22H23N3O3S2/c26-21(17-10-4-1-5-11-17)24-30(27,28)22-23-20(16-29-22)25(18-12-6-2-7-13-18)19-14-8-3-9-15-19/h2-3,6-9,12-17H,1,4-5,10-11H2,(H,24,26) |
| InChIKey | PFSRJBLLUXEGTR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |