C24H30F3NO7 — CID 67928371
3-[2-[4-(2-ethoxyethoxy)phenyl]ethylamino]-2-[3-(trifluoromethyl)phenyl]propan-1-ol;oxalic acid (PubChem CID 67928371) has the molecular formula C24H30F3NO7 and a molecular weight of 501.50 g/mol. Its IUPAC name is 3-[2-[4-(2-ethoxyethoxy)phenyl]ethylamino]-2-[3-(trifluoromethyl)phenyl]propan-1-ol;oxalic acid.
| Compound Name | 3-[2-[4-(2-ethoxyethoxy)phenyl]ethylamino]-2-[3-(trifluoromethyl)phenyl]propan-1-ol;oxalic acid |
|---|---|
| PubChem CID | 67928371 |
| Molecular Formula | C24H30F3NO7 |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 3-[2-[4-(2-ethoxyethoxy)phenyl]ethylamino]-2-[3-(trifluoromethyl)phenyl]propan-1-ol;oxalic acid |
| SMILES | CCOCCOc1ccc(CCNCC(CO)c2cccc(C(F)(F)F)c2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H28F3NO3.C2H2O4/c1-2-28-12-13-29-21-8-6-17(7-9-21)10-11-26-15-19(16-27)18-4-3-5-20(14-18)22(23,24)25;3-1(4)2(5)6/h3-9,14,19,26-27H,2,10-13,15-16H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | IGFSHRUTWLPAAP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|