C23H28ClNO6 — CID 67928398
2-[2-(3-chlorophenyl)-3-[2-[4-(2-ethoxyethoxy)phenyl]ethylamino]propoxy]-2-oxoacetic acid (PubChem CID 67928398) has the molecular formula C23H28ClNO6 and a molecular weight of 449.93 g/mol. Its IUPAC name is 2-[2-(3-chlorophenyl)-3-[2-[4-(2-ethoxyethoxy)phenyl]ethylamino]propoxy]-2-oxoacetic acid.
| Compound Name | 2-[2-(3-chlorophenyl)-3-[2-[4-(2-ethoxyethoxy)phenyl]ethylamino]propoxy]-2-oxoacetic acid |
|---|---|
| PubChem CID | 67928398 |
| Molecular Formula | C23H28ClNO6 |
| Molecular Weight | 449.93 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 2-[2-(3-chlorophenyl)-3-[2-[4-(2-ethoxyethoxy)phenyl]ethylamino]propoxy]-2-oxoacetic acid |
| SMILES | CCOCCOc1ccc(CCNCC(COC(=O)C(=O)O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C23H28ClNO6/c1-2-29-12-13-30-21-8-6-17(7-9-21)10-11-25-15-19(16-31-23(28)22(26)27)18-4-3-5-20(24)14-18/h3-9,14,19,25H,2,10-13,15-16H2,1H3,(H,26,27) |
| InChIKey | LMVWGPUSMYVZPH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.93 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|