C27H28O5 — CID 67930773
(1R,2S,5R)-2,4,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane (PubChem CID 67930773) has the molecular formula C27H28O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is (1R,2S,5R)-2,4,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane.
| Compound Name | (1R,2S,5R)-2,4,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 67930773 |
| Molecular Formula | C27H28O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | (1R,2S,5R)-2,4,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane |
| SMILES | c1ccc(CO[C@H]2CC(OCc3ccccc3)(OCc3ccccc3)[C@@H]3OC[C@H]2O3)cc1 |
| InChI | InChI=1S/C27H28O5/c1-4-10-21(11-5-1)17-28-24-16-27(26-29-20-25(24)32-26,30-18-22-12-6-2-7-13-22)31-19-23-14-8-3-9-15-23/h1-15,24-26H,16-20H2/t24-,25+,26+/m0/s1 |
| InChIKey | HDYYEMUNVGIZNW-JIMJEQGWSA-N |
| XLogP | 4.85 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|