C12H14BrClO3 — CID 67932133
1-[2-(bromomethyl)-2-(4-chlorophenyl)-1,3-dioxolan-4-yl]ethanol (PubChem CID 67932133) has the molecular formula C12H14BrClO3 and a molecular weight of 321.60 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-2-(4-chlorophenyl)-1,3-dioxolan-4-yl]ethanol.
| Compound Name | 1-[2-(bromomethyl)-2-(4-chlorophenyl)-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 67932133 |
| Molecular Formula | C12H14BrClO3 |
| Molecular Weight | 321.60 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | 1-[2-(bromomethyl)-2-(4-chlorophenyl)-1,3-dioxolan-4-yl]ethanol |
| SMILES | CC(O)C1COC(CBr)(c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C12H14BrClO3/c1-8(15)11-6-16-12(7-13,17-11)9-2-4-10(14)5-3-9/h2-5,8,11,15H,6-7H2,1H3 |
| InChIKey | RJAOZUIMVLLLJF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.60 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|