C24H31ClN2O2 — CID 67935745
1-[3-(dibenzylamino)propyl]-3-ethyl-3-methylpyrrolidine-2,5-dione;hydrochloride (PubChem CID 67935745) has the molecular formula C24H31ClN2O2 and a molecular weight of 414.98 g/mol. Its IUPAC name is 1-[3-(dibenzylamino)propyl]-3-ethyl-3-methylpyrrolidine-2,5-dione;hydrochloride.
| Compound Name | 1-[3-(dibenzylamino)propyl]-3-ethyl-3-methylpyrrolidine-2,5-dione;hydrochloride |
|---|---|
| PubChem CID | 67935745 |
| Molecular Formula | C24H31ClN2O2 |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 1-[3-(dibenzylamino)propyl]-3-ethyl-3-methylpyrrolidine-2,5-dione;hydrochloride |
| SMILES | CCC1(C)CC(=O)N(CCCN(Cc2ccccc2)Cc2ccccc2)C1=O.Cl |
| InChI | InChI=1S/C24H30N2O2.ClH/c1-3-24(2)17-22(27)26(23(24)28)16-10-15-25(18-20-11-6-4-7-12-20)19-21-13-8-5-9-14-21;/h4-9,11-14H,3,10,15-19H2,1-2H3;1H |
| InChIKey | HKIUHTWLHJDYCA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|