About 2-methylbut-3-en-2-yl 4-anilinobutanoate
2-methylbut-3-en-2-yl 4-anilinobutanoate (PubChem CID 67953027) has the molecular formula C15H21NO2
and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-methylbut-3-en-2-yl 4-anilinobutanoate.
Molecular Properties
| Compound Name | 2-methylbut-3-en-2-yl 4-anilinobutanoate |
| PubChem CID | 67953027 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 2-methylbut-3-en-2-yl 4-anilinobutanoate |
| SMILES | C=CC(C)(C)OC(=O)CCCNc1ccccc1 |
| InChI | InChI=1S/C15H21NO2/c1-4-15(2,3)18-14(17)11-8-12-16-13-9-6-5-7-10-13/h4-7,9-10,16H,1,8,11-12H2,2-3H3 |
| InChIKey | VSEXEYJLIHZPFK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbut-3-en-2-yl 4-anilinobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbut-3-en-2-yl 4-anilinobutanoate?
The IUPAC name of 2-methylbut-3-en-2-yl 4-anilinobutanoate (CID 67953027) is 2-methylbut-3-en-2-yl 4-anilinobutanoate.
What is the SMILES notation for 2-methylbut-3-en-2-yl 4-anilinobutanoate?
The canonical SMILES for 2-methylbut-3-en-2-yl 4-anilinobutanoate is C=CC(C)(C)OC(=O)CCCNc1ccccc1.
What is the InChIKey of 2-methylbut-3-en-2-yl 4-anilinobutanoate?
The InChIKey is VSEXEYJLIHZPFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2/c1-4-15(2,3)18-14(17)11-8-12-16-13-9-6-5-7-10-13/h4-7,9-10,16H,1,8,11-12H2,2-3H3.
What are the key properties of 2-methylbut-3-en-2-yl 4-anilinobutanoate?
2-methylbut-3-en-2-yl 4-anilinobutanoate has a molecular weight of 247.34 g/mol, XLogP of 3.39, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbut-3-en-2-yl 4-anilinobutanoate is sourced from PubChem (CID 67953027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).