C17H24N4O2 — CID 67976724
1-[(1-tert-butylpiperidin-3-yl)methyl]-4-nitroindazole (PubChem CID 67976724) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-[(1-tert-butylpiperidin-3-yl)methyl]-4-nitroindazole.
| Compound Name | 1-[(1-tert-butylpiperidin-3-yl)methyl]-4-nitroindazole |
|---|---|
| PubChem CID | 67976724 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1-[(1-tert-butylpiperidin-3-yl)methyl]-4-nitroindazole |
| SMILES | CC(C)(C)N1CCCC(Cn2ncc3c([N+](=O)[O-])cccc32)C1 |
| InChI | InChI=1S/C17H24N4O2/c1-17(2,3)19-9-5-6-13(11-19)12-20-15-7-4-8-16(21(22)23)14(15)10-18-20/h4,7-8,10,13H,5-6,9,11-12H2,1-3H3 |
| InChIKey | QVBSHTXIWMYEBO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|