C9H14N2O7 — CID 67980935
(3R,4S,5R)-5-(hydroxymethyl)oxolane-2,3,4-triol;2-nitro-1H-pyrrole (PubChem CID 67980935) has the molecular formula C9H14N2O7 and a molecular weight of 262.22 g/mol. Its IUPAC name is (3R,4S,5R)-5-(hydroxymethyl)oxolane-2,3,4-triol;2-nitro-1H-pyrrole.
| Compound Name | (3R,4S,5R)-5-(hydroxymethyl)oxolane-2,3,4-triol;2-nitro-1H-pyrrole |
|---|---|
| PubChem CID | 67980935 |
| Molecular Formula | C9H14N2O7 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | (3R,4S,5R)-5-(hydroxymethyl)oxolane-2,3,4-triol;2-nitro-1H-pyrrole |
| SMILES | O=[N+]([O-])c1ccc[nH]1.OC[C@H]1OC(O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C5H10O5.C4H4N2O2/c6-1-2-3(7)4(8)5(9)10-2;7-6(8)4-2-1-3-5-4/h2-9H,1H2;1-3,5H/t2-,3-,4-,5?;/m1./s1 |
| InChIKey | ILWCBBLLOIEEEQ-QHEAFLAXSA-N |
| XLogP | -1.66 |
| TPSA | 149.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|