C25H29FN2O4S — CID 68506181
2-cyclopentyl-N-(4-fluorophenyl)-N'-(2-phenylethenylsulfonyl)-N-propan-2-ylpropanediamide (PubChem CID 68506181) has the molecular formula C25H29FN2O4S and a molecular weight of 472.58 g/mol. Its IUPAC name is 2-cyclopentyl-N-(4-fluorophenyl)-N'-(2-phenylethenylsulfonyl)-N-propan-2-ylpropanediamide.
| Compound Name | 2-cyclopentyl-N-(4-fluorophenyl)-N'-(2-phenylethenylsulfonyl)-N-propan-2-ylpropanediamide |
|---|---|
| PubChem CID | 68506181 |
| Molecular Formula | C25H29FN2O4S |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 2-cyclopentyl-N-(4-fluorophenyl)-N'-(2-phenylethenylsulfonyl)-N-propan-2-ylpropanediamide |
| SMILES | CC(C)N(C(=O)C(C(=O)NS(=O)(=O)C=Cc1ccccc1)C1CCCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H29FN2O4S/c1-18(2)28(22-14-12-21(26)13-15-22)25(30)23(20-10-6-7-11-20)24(29)27-33(31,32)17-16-19-8-4-3-5-9-19/h3-5,8-9,12-18,20,23H,6-7,10-11H2,1-2H3,(H,27,29) |
| InChIKey | HIFHVKDDTGTXJA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|