C19H14Br2N2O4 — CID 68528301
3-[3,5-dibromo-4-(2-methylquinolin-6-yl)oxyanilino]-3-oxopropanoic acid (PubChem CID 68528301) has the molecular formula C19H14Br2N2O4 and a molecular weight of 494.14 g/mol. Its IUPAC name is 3-[3,5-dibromo-4-(2-methylquinolin-6-yl)oxyanilino]-3-oxopropanoic acid.
| Compound Name | 3-[3,5-dibromo-4-(2-methylquinolin-6-yl)oxyanilino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 68528301 |
| Molecular Formula | C19H14Br2N2O4 |
| Molecular Weight | 494.14 g/mol |
| Exact Mass | 491.93 |
| IUPAC Name | 3-[3,5-dibromo-4-(2-methylquinolin-6-yl)oxyanilino]-3-oxopropanoic acid |
| SMILES | Cc1ccc2cc(Oc3c(Br)cc(NC(=O)CC(=O)O)cc3Br)ccc2n1 |
| InChI | InChI=1S/C19H14Br2N2O4/c1-10-2-3-11-6-13(4-5-16(11)22-10)27-19-14(20)7-12(8-15(19)21)23-17(24)9-18(25)26/h2-8H,9H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | QYHAKGBGYJMMHJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.14 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|