C20H16AsBr2N2O6S — CID 87784643
CID 87784643 (PubChem CID 87784643) has the molecular formula C20H16AsBr2N2O6S and a molecular weight of 647.15 g/mol.
| Compound Name | CID 87784643 |
|---|---|
| PubChem CID | 87784643 |
| Molecular Formula | C20H16AsBr2N2O6S |
| Molecular Weight | 647.15 g/mol |
| Exact Mass | 644.83 |
| IUPAC Name | — |
| SMILES | CS(=O)(=O)[As]Cc1ccc2cc(Oc3c(Br)cc(NC(=O)CC(=O)O)cc3Br)ccc2n1 |
| InChI | InChI=1S/C20H16AsBr2N2O6S/c1-32(29,30)21-10-12-3-2-11-6-14(4-5-17(11)24-12)31-20-15(22)7-13(8-16(20)23)25-18(26)9-19(27)28/h2-8H,9-10H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | KSFBEKNCPXGYEW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 122.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.15 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|