C14H15N7O4 — CID 68537794
1-methyl-6-[(2-nitrophenyl)methyl]-3-(tetrazol-2-ylmethyl)piperazine-2,5-dione (PubChem CID 68537794) has the molecular formula C14H15N7O4 and a molecular weight of 345.32 g/mol. Its IUPAC name is 1-methyl-6-[(2-nitrophenyl)methyl]-3-(tetrazol-2-ylmethyl)piperazine-2,5-dione.
| Compound Name | 1-methyl-6-[(2-nitrophenyl)methyl]-3-(tetrazol-2-ylmethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 68537794 |
| Molecular Formula | C14H15N7O4 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 1-methyl-6-[(2-nitrophenyl)methyl]-3-(tetrazol-2-ylmethyl)piperazine-2,5-dione |
| SMILES | CN1C(=O)C(Cn2ncnn2)NC(=O)C1Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15N7O4/c1-19-12(6-9-4-2-3-5-11(9)21(24)25)13(22)17-10(14(19)23)7-20-16-8-15-18-20/h2-5,8,10,12H,6-7H2,1H3,(H,17,22) |
| InChIKey | YRLLVGQXZXQHAK-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|