C12H13Cl2NO2 — CID 68542661
methyl (Z)-3-(3,5-dichloroanilino)pent-2-enoate (PubChem CID 68542661) has the molecular formula C12H13Cl2NO2 and a molecular weight of 274.15 g/mol. Its IUPAC name is methyl (Z)-3-(3,5-dichloroanilino)pent-2-enoate.
| Compound Name | methyl (Z)-3-(3,5-dichloroanilino)pent-2-enoate |
|---|---|
| PubChem CID | 68542661 |
| Molecular Formula | C12H13Cl2NO2 |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | methyl (Z)-3-(3,5-dichloroanilino)pent-2-enoate |
| SMILES | CC/C(=C/C(=O)OC)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2NO2/c1-3-10(7-12(16)17-2)15-11-5-8(13)4-9(14)6-11/h4-7,15H,3H2,1-2H3/b10-7- |
| InChIKey | LPRDTVDQUIGSIG-YFHOEESVSA-N |
| XLogP | 3.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|