C6H11ClO4 — CID 68562521
(2S,3R,5S)-5-[chloro(hydroxy)methyl]-2-methoxyoxolan-3-ol (PubChem CID 68562521) has the molecular formula C6H11ClO4 and a molecular weight of 182.60 g/mol. Its IUPAC name is (2S,3R,5S)-5-[chloro(hydroxy)methyl]-2-methoxyoxolan-3-ol.
| Compound Name | (2S,3R,5S)-5-[chloro(hydroxy)methyl]-2-methoxyoxolan-3-ol |
|---|---|
| PubChem CID | 68562521 |
| Molecular Formula | C6H11ClO4 |
| Molecular Weight | 182.60 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | (2S,3R,5S)-5-[chloro(hydroxy)methyl]-2-methoxyoxolan-3-ol |
| SMILES | CO[C@H]1O[C@H](C(O)Cl)C[C@H]1O |
| InChI | InChI=1S/C6H11ClO4/c1-10-6-3(8)2-4(11-6)5(7)9/h3-6,8-9H,2H2,1H3/t3-,4+,5?,6+/m1/s1 |
| InChIKey | HYLRTSJHHLQGHR-JTSAIASGSA-N |
| XLogP | -0.33 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.60 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|