C25H32N4O — CID 68563740
N,N'-diethyl-N'-(7-methoxy-5,11-dimethyl-10H-pyrido[2,3-b]carbazol-4-yl)propane-1,3-diamine (PubChem CID 68563740) has the molecular formula C25H32N4O and a molecular weight of 404.56 g/mol. Its IUPAC name is N,N'-diethyl-N'-(7-methoxy-5,11-dimethyl-10H-pyrido[2,3-b]carbazol-4-yl)propane-1,3-diamine.
| Compound Name | N,N'-diethyl-N'-(7-methoxy-5,11-dimethyl-10H-pyrido[2,3-b]carbazol-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 68563740 |
| Molecular Formula | C25H32N4O |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | N,N'-diethyl-N'-(7-methoxy-5,11-dimethyl-10H-pyrido[2,3-b]carbazol-4-yl)propane-1,3-diamine |
| SMILES | CCNCCCN(CC)c1ccnc2c(C)c3[nH]c4ccc(OC)cc4c3c(C)c12 |
| InChI | InChI=1S/C25H32N4O/c1-6-26-12-8-14-29(7-2)21-11-13-27-24-17(4)25-22(16(3)23(21)24)19-15-18(30-5)9-10-20(19)28-25/h9-11,13,15,26,28H,6-8,12,14H2,1-5H3 |
| InChIKey | BSFJWKIAKNYEAO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|