C37H49NO11 — CID 68596357
[2-methoxy-4-[(1R)-4-nitrooxy-1-prop-2-enoyloxybutyl]phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoate (PubChem CID 68596357) has the molecular formula C37H49NO11 and a molecular weight of 683.80 g/mol. Its IUPAC name is [2-methoxy-4-[(1R)-4-nitrooxy-1-prop-2-enoyloxybutyl]phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoate.
| Compound Name | [2-methoxy-4-[(1R)-4-nitrooxy-1-prop-2-enoyloxybutyl]phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 68596357 |
| Molecular Formula | C37H49NO11 |
| Molecular Weight | 683.80 g/mol |
| Exact Mass | 683.33 |
| IUPAC Name | [2-methoxy-4-[(1R)-4-nitrooxy-1-prop-2-enoyloxybutyl]phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoate |
| SMILES | C=CC(=O)O[C@H](CCCO[N+](=O)[O-])c1ccc(OC(=O)CCC/C=C\C[C@@H]2[C@@H](CCC(O)CCc3ccccc3)[C@H](O)C[C@@H]2O)c(OC)c1 |
| InChI | InChI=1S/C37H49NO11/c1-3-36(42)48-33(15-11-23-47-38(44)45)27-18-22-34(35(24-27)46-2)49-37(43)16-10-5-4-9-14-29-30(32(41)25-31(29)40)21-20-28(39)19-17-26-12-7-6-8-13-26/h3-4,6-9,12-13,18,22,24,28-33,39-41H,1,5,10-11,14-17,19-21,23,25H2,2H3/b9-4-/t28?,29-,30-,31+,32-,33-/m1/s1 |
| InChIKey | ONZSZVGCDMRUAR-UMAVEBMKSA-N |
| XLogP | 5.61 |
| TPSA | 174.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.80 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|