C37H49NO11 — CID 142683951
[4-(2-methoxy-4-nitrooxy-1-prop-2-enoyloxybutyl)phenyl] (E)-7-[3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoate (PubChem CID 142683951) has the molecular formula C37H49NO11 and a molecular weight of 683.80 g/mol. Its IUPAC name is [4-(2-methoxy-4-nitrooxy-1-prop-2-enoyloxybutyl)phenyl] (E)-7-[3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoate.
| Compound Name | [4-(2-methoxy-4-nitrooxy-1-prop-2-enoyloxybutyl)phenyl] (E)-7-[3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 142683951 |
| Molecular Formula | C37H49NO11 |
| Molecular Weight | 683.80 g/mol |
| Exact Mass | 683.33 |
| IUPAC Name | [4-(2-methoxy-4-nitrooxy-1-prop-2-enoyloxybutyl)phenyl] (E)-7-[3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoate |
| SMILES | C=CC(=O)OC(c1ccc(OC(=O)CCC/C=C/CC2C(O)CC(O)C2CCC(O)CCc2ccccc2)cc1)C(CCO[N+](=O)[O-])OC |
| InChI | InChI=1S/C37H49NO11/c1-3-35(42)49-37(34(46-2)23-24-47-38(44)45)27-16-20-29(21-17-27)48-36(43)14-10-5-4-9-13-30-31(33(41)25-32(30)40)22-19-28(39)18-15-26-11-7-6-8-12-26/h3-4,6-9,11-12,16-17,20-21,28,30-34,37,39-41H,1,5,10,13-15,18-19,22-25H2,2H3/b9-4+ |
| InChIKey | KRCRQKMISABTCO-RUDMXATFSA-N |
| XLogP | 5.22 |
| TPSA | 174.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.80 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|