C35H45NO11 — CID 91094461
[2-methoxy-4-[(1R)-2-nitrooxy-1-prop-2-enoyloxyethyl]phenyl] 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoate (PubChem CID 91094461) has the molecular formula C35H45NO11 and a molecular weight of 655.74 g/mol. Its IUPAC name is [2-methoxy-4-[(1R)-2-nitrooxy-1-prop-2-enoyloxyethyl]phenyl] 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoate.
| Compound Name | [2-methoxy-4-[(1R)-2-nitrooxy-1-prop-2-enoyloxyethyl]phenyl] 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 91094461 |
| Molecular Formula | C35H45NO11 |
| Molecular Weight | 655.74 g/mol |
| Exact Mass | 655.30 |
| IUPAC Name | [2-methoxy-4-[(1R)-2-nitrooxy-1-prop-2-enoyloxyethyl]phenyl] 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoate |
| SMILES | C=CC(=O)O[C@@H](CO[N+](=O)[O-])c1ccc(OC(=O)CCCC=CC[C@@H]2[C@@H](CCC(O)CCc3ccccc3)[C@H](O)C[C@@H]2O)c(OC)c1 |
| InChI | InChI=1S/C35H45NO11/c1-3-34(40)47-33(23-45-36(42)43)25-16-20-31(32(21-25)44-2)46-35(41)14-10-5-4-9-13-27-28(30(39)22-29(27)38)19-18-26(37)17-15-24-11-7-6-8-12-24/h3-4,6-9,11-12,16,20-21,26-30,33,37-39H,1,5,10,13-15,17-19,22-23H2,2H3/t26?,27-,28-,29+,30-,33+/m1/s1 |
| InChIKey | RSAOVRKKBKJOEV-YLGIKXDFSA-N |
| XLogP | 4.83 |
| TPSA | 174.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.74 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|