C19H31N3O2 — CID 68621026
[(3aR,4S,6aS)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methanamine;2-benzylpyrrolidine (PubChem CID 68621026) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is [(3aR,4S,6aS)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methanamine;2-benzylpyrrolidine.
| Compound Name | [(3aR,4S,6aS)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methanamine;2-benzylpyrrolidine |
|---|---|
| PubChem CID | 68621026 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | [(3aR,4S,6aS)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methanamine;2-benzylpyrrolidine |
| SMILES | CC1(C)O[C@@H]2[C@H](CN)NC[C@@H]2O1.c1ccc(CC2CCCN2)cc1 |
| InChI | InChI=1S/C11H15N.C8H16N2O2/c1-2-5-10(6-3-1)9-11-7-4-8-12-11;1-8(2)11-6-4-10-5(3-9)7(6)12-8/h1-3,5-6,11-12H,4,7-9H2;5-7,10H,3-4,9H2,1-2H3/t;5-,6-,7+/m.0/s1 |
| InChIKey | SKGWCBGXPASQMR-KISWOZELSA-N |
| XLogP | 1.42 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |