C21H35N3O6 — CID 68623619
[(2S,3S,5S)-1-amino-2-hydroxy-5-[[[2-(3-methoxypropoxy)benzoyl]amino]methyl]-6-methylheptan-3-yl]carbamic acid (PubChem CID 68623619) has the molecular formula C21H35N3O6 and a molecular weight of 425.53 g/mol. Its IUPAC name is [(2S,3S,5S)-1-amino-2-hydroxy-5-[[[2-(3-methoxypropoxy)benzoyl]amino]methyl]-6-methylheptan-3-yl]carbamic acid.
| Compound Name | [(2S,3S,5S)-1-amino-2-hydroxy-5-[[[2-(3-methoxypropoxy)benzoyl]amino]methyl]-6-methylheptan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 68623619 |
| Molecular Formula | C21H35N3O6 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | [(2S,3S,5S)-1-amino-2-hydroxy-5-[[[2-(3-methoxypropoxy)benzoyl]amino]methyl]-6-methylheptan-3-yl]carbamic acid |
| SMILES | COCCCOc1ccccc1C(=O)NC[C@@H](C[C@H](NC(=O)O)[C@@H](O)CN)C(C)C |
| InChI | InChI=1S/C21H35N3O6/c1-14(2)15(11-17(18(25)12-22)24-21(27)28)13-23-20(26)16-7-4-5-8-19(16)30-10-6-9-29-3/h4-5,7-8,14-15,17-18,24-25H,6,9-13,22H2,1-3H3,(H,23,26)(H,27,28)/t15-,17+,18+/m1/s1 |
| InChIKey | FAOQXMXSYUOGII-NJAFHUGGSA-N |
| XLogP | 1.45 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|