C28H33NO4Si — CID 68635048
ethyl 4-[[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-pyridinyl]oxy]but-2-enoate (PubChem CID 68635048) has the molecular formula C28H33NO4Si and a molecular weight of 475.66 g/mol. Its IUPAC name is ethyl 4-[[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-pyridinyl]oxy]but-2-enoate.
| Compound Name | ethyl 4-[[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-pyridinyl]oxy]but-2-enoate |
|---|---|
| PubChem CID | 68635048 |
| Molecular Formula | C28H33NO4Si |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | ethyl 4-[[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-pyridinyl]oxy]but-2-enoate |
| SMILES | CCOC(=O)C=CCOc1cccnc1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H33NO4Si/c1-5-31-27(30)19-13-21-32-26-18-12-20-29-25(26)22-33-34(28(2,3)4,23-14-8-6-9-15-23)24-16-10-7-11-17-24/h6-20H,5,21-22H2,1-4H3 |
| InChIKey | JXIWMAXOLLCJFO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|