C18H22N2 — CID 68655204
N,N-diethyl-4-[(E)-3-pyridin-4-ylprop-1-enyl]aniline (PubChem CID 68655204) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is N,N-diethyl-4-[(E)-3-pyridin-4-ylprop-1-enyl]aniline.
| Compound Name | N,N-diethyl-4-[(E)-3-pyridin-4-ylprop-1-enyl]aniline |
|---|---|
| PubChem CID | 68655204 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | N,N-diethyl-4-[(E)-3-pyridin-4-ylprop-1-enyl]aniline |
| SMILES | CCN(CC)c1ccc(/C=C/Cc2ccncc2)cc1 |
| InChI | InChI=1S/C18H22N2/c1-3-20(4-2)18-10-8-16(9-11-18)6-5-7-17-12-14-19-15-13-17/h5-6,8-15H,3-4,7H2,1-2H3/b6-5+ |
| InChIKey | GSHWLQKMOJELJZ-AATRIKPKSA-N |
| XLogP | 4.18 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|