C35H80O10Si5 — CID 68656532
2,4,6,8,10-pentatert-butyl-2,4,6,8,10-penta(propan-2-yloxy)-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane (PubChem CID 68656532) has the molecular formula C35H80O10Si5 and a molecular weight of 801.44 g/mol. Its IUPAC name is 2,4,6,8,10-pentatert-butyl-2,4,6,8,10-penta(propan-2-yloxy)-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane.
| Compound Name | 2,4,6,8,10-pentatert-butyl-2,4,6,8,10-penta(propan-2-yloxy)-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
|---|---|
| PubChem CID | 68656532 |
| Molecular Formula | C35H80O10Si5 |
| Molecular Weight | 801.44 g/mol |
| Exact Mass | 800.46 |
| IUPAC Name | 2,4,6,8,10-pentatert-butyl-2,4,6,8,10-penta(propan-2-yloxy)-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
| SMILES | CC(C)O[Si]1(C(C)(C)C)O[Si](OC(C)C)(C(C)(C)C)O[Si](OC(C)C)(C(C)(C)C)O[Si](OC(C)C)(C(C)(C)C)O[Si](OC(C)C)(C(C)(C)C)O1 |
| InChI | InChI=1S/C35H80O10Si5/c1-26(2)36-46(31(11,12)13)41-47(32(14,15)16,37-27(3)4)43-49(34(20,21)22,39-29(7)8)45-50(35(23,24)25,40-30(9)10)44-48(42-46,33(17,18)19)38-28(5)6/h26-30H,1-25H3 |
| InChIKey | ALVHZEFRKVONIG-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.44 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|