C24H54O3Si3 — CID 634487
2,2,4,4,6,6-hexatert-butyl-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 634487) has the molecular formula C24H54O3Si3 and a molecular weight of 474.95 g/mol. Its IUPAC name is 2,2,4,4,6,6-hexatert-butyl-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2,2,4,4,6,6-hexatert-butyl-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 634487 |
| Molecular Formula | C24H54O3Si3 |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.34 |
| IUPAC Name | 2,2,4,4,6,6-hexatert-butyl-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)O[Si](C(C)(C)C)(C(C)(C)C)O[Si](C(C)(C)C)(C(C)(C)C)O1 |
| InChI | InChI=1S/C24H54O3Si3/c1-19(2,3)28(20(4,5)6)25-29(21(7,8)9,22(10,11)12)27-30(26-28,23(13,14)15)24(16,17)18/h1-18H3 |
| InChIKey | JJVBZRJJLKKWQD-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|