C10H18N4 — CID 686652
7-(1,6-diazabicyclo[4.1.0]heptan-7-yl)-1,6-diazabicyclo[4.1.0]heptane (PubChem CID 686652) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 7-(1,6-diazabicyclo[4.1.0]heptan-7-yl)-1,6-diazabicyclo[4.1.0]heptane.
| Compound Name | 7-(1,6-diazabicyclo[4.1.0]heptan-7-yl)-1,6-diazabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 686652 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 7-(1,6-diazabicyclo[4.1.0]heptan-7-yl)-1,6-diazabicyclo[4.1.0]heptane |
| SMILES | C1CCN2C(C3N4CCCCN34)N2C1 |
| InChI | InChI=1S/C10H18N4/c1-2-6-12-9(11(12)5-1)10-13-7-3-4-8-14(10)13/h9-10H,1-8H2 |
| InChIKey | KCGOBZMNIBUNCB-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 12.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|