C21H28N4O3 — CID 68689436
tert-butyl-[1-[(11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl)methyl]piperidin-4-yl]carbamic acid (PubChem CID 68689436) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is tert-butyl-[1-[(11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl)methyl]piperidin-4-yl]carbamic acid.
| Compound Name | tert-butyl-[1-[(11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl)methyl]piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 68689436 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | tert-butyl-[1-[(11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl)methyl]piperidin-4-yl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1CCN(CC2Cn3c(=O)ccc4nccc2c43)CC1 |
| InChI | InChI=1S/C21H28N4O3/c1-21(2,3)25(20(27)28)15-7-10-23(11-8-15)12-14-13-24-18(26)5-4-17-19(24)16(14)6-9-22-17/h4-6,9,14-15H,7-8,10-13H2,1-3H3,(H,27,28) |
| InChIKey | UCKFXUXENDKZNQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |