C29H26O3 — CID 68718700
3,3-diphenyl-2,4-dihydrobenzo[h]chromene;2-methylprop-2-enoic acid (PubChem CID 68718700) has the molecular formula C29H26O3 and a molecular weight of 422.52 g/mol. Its IUPAC name is 3,3-diphenyl-2,4-dihydrobenzo[h]chromene;2-methylprop-2-enoic acid.
| Compound Name | 3,3-diphenyl-2,4-dihydrobenzo[h]chromene;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 68718700 |
| Molecular Formula | C29H26O3 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 3,3-diphenyl-2,4-dihydrobenzo[h]chromene;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.c1ccc(C2(c3ccccc3)COc3c(ccc4ccccc34)C2)cc1 |
| InChI | InChI=1S/C25H20O.C4H6O2/c1-3-10-21(11-4-1)25(22-12-5-2-6-13-22)17-20-16-15-19-9-7-8-14-23(19)24(20)26-18-25;1-3(2)4(5)6/h1-16H,17-18H2;1H2,2H3,(H,5,6) |
| InChIKey | KNTVYCZUIZSYQS-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|