C10H15BrN2O4S2 — CID 68740912
3-[(5-bromothiophen-2-yl)sulfonylamino]-4-(dimethylamino)butanoic acid (PubChem CID 68740912) has the molecular formula C10H15BrN2O4S2 and a molecular weight of 371.28 g/mol. Its IUPAC name is 3-[(5-bromothiophen-2-yl)sulfonylamino]-4-(dimethylamino)butanoic acid.
| Compound Name | 3-[(5-bromothiophen-2-yl)sulfonylamino]-4-(dimethylamino)butanoic acid |
|---|---|
| PubChem CID | 68740912 |
| Molecular Formula | C10H15BrN2O4S2 |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | 3-[(5-bromothiophen-2-yl)sulfonylamino]-4-(dimethylamino)butanoic acid |
| SMILES | CN(C)CC(CC(=O)O)NS(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C10H15BrN2O4S2/c1-13(2)6-7(5-9(14)15)12-19(16,17)10-4-3-8(11)18-10/h3-4,7,12H,5-6H2,1-2H3,(H,14,15) |
| InChIKey | DKIVDSHYIXLRCG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |