About aminooxy-(2,4-dibenzoylphenyl)borinic acid
aminooxy-(2,4-dibenzoylphenyl)borinic acid (PubChem CID 68788292) has the molecular formula C20H16BNO4
and a molecular weight of 345.16 g/mol. Its IUPAC name is aminooxy-(2,4-dibenzoylphenyl)borinic acid.
Molecular Properties
| Compound Name | aminooxy-(2,4-dibenzoylphenyl)borinic acid |
| PubChem CID | 68788292 |
| Molecular Formula | C20H16BNO4 |
| Molecular Weight | 345.16 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | aminooxy-(2,4-dibenzoylphenyl)borinic acid |
| SMILES | NOB(O)c1ccc(C(=O)c2ccccc2)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H16BNO4/c22-26-21(25)18-12-11-16(19(23)14-7-3-1-4-8-14)13-17(18)20(24)15-9-5-2-6-10-15/h1-13,25H,22H2 |
| InChIKey | VNMBLRVXIFSVOS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.16 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze aminooxy-(2,4-dibenzoylphenyl)borinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aminooxy-(2,4-dibenzoylphenyl)borinic acid?
The IUPAC name of aminooxy-(2,4-dibenzoylphenyl)borinic acid (CID 68788292) is aminooxy-(2,4-dibenzoylphenyl)borinic acid.
What is the SMILES notation for aminooxy-(2,4-dibenzoylphenyl)borinic acid?
The canonical SMILES for aminooxy-(2,4-dibenzoylphenyl)borinic acid is NOB(O)c1ccc(C(=O)c2ccccc2)cc1C(=O)c1ccccc1.
What is the InChIKey of aminooxy-(2,4-dibenzoylphenyl)borinic acid?
The InChIKey is VNMBLRVXIFSVOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16BNO4/c22-26-21(25)18-12-11-16(19(23)14-7-3-1-4-8-14)13-17(18)20(24)15-9-5-2-6-10-15/h1-13,25H,22H2.
What are the key properties of aminooxy-(2,4-dibenzoylphenyl)borinic acid?
aminooxy-(2,4-dibenzoylphenyl)borinic acid has a molecular weight of 345.16 g/mol, XLogP of 1.73, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for aminooxy-(2,4-dibenzoylphenyl)borinic acid is sourced from PubChem (CID 68788292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).