C23H19N3O3 — CID 68789843
(3-hydroxypyrrolidin-1-yl) 2-[4-(2-pyridin-3-ylethynyl)phenyl]pyridine-4-carboxylate (PubChem CID 68789843) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is (3-hydroxypyrrolidin-1-yl) 2-[4-(2-pyridin-3-ylethynyl)phenyl]pyridine-4-carboxylate.
| Compound Name | (3-hydroxypyrrolidin-1-yl) 2-[4-(2-pyridin-3-ylethynyl)phenyl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 68789843 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | (3-hydroxypyrrolidin-1-yl) 2-[4-(2-pyridin-3-ylethynyl)phenyl]pyridine-4-carboxylate |
| SMILES | O=C(ON1CCC(O)C1)c1ccnc(-c2ccc(C#Cc3cccnc3)cc2)c1 |
| InChI | InChI=1S/C23H19N3O3/c27-21-10-13-26(16-21)29-23(28)20-9-12-25-22(14-20)19-7-5-17(6-8-19)3-4-18-2-1-11-24-15-18/h1-2,5-9,11-12,14-15,21,27H,10,13,16H2 |
| InChIKey | LOZAQQUTNCEBJH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|