C25H34INO3 — CID 68803551
2-[(1R,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]-1,1-bis(2-methoxyphenyl)ethanol iodide (PubChem CID 68803551) has the molecular formula C25H34INO3 and a molecular weight of 523.46 g/mol. Its IUPAC name is 2-[(1R,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]-1,1-bis(2-methoxyphenyl)ethanol iodide.
| Compound Name | 2-[(1R,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]-1,1-bis(2-methoxyphenyl)ethanol iodide |
|---|---|
| PubChem CID | 68803551 |
| Molecular Formula | C25H34INO3 |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 2-[(1R,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]-1,1-bis(2-methoxyphenyl)ethanol iodide |
| SMILES | COc1ccccc1C(O)(CC1C[C@H]2CC[C@@H](C1)[N+]2(C)C)c1ccccc1OC.[I-] |
| InChI | InChI=1S/C25H34NO3.HI/c1-26(2)19-13-14-20(26)16-18(15-19)17-25(27,21-9-5-7-11-23(21)28-3)22-10-6-8-12-24(22)29-4;/h5-12,18-20,27H,13-17H2,1-4H3;1H/q+1;/p-1/t18?,19-,20+; |
| InChIKey | IPMBYVCXJQRHLV-VXLMLQOVSA-M |
| XLogP | 1.35 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|