C23H25N3O6S2 — CID 68807586
ethyl 3-[3-[(3-aminophenyl)sulfonylamino]phenyl]-2-(benzenesulfonamido)propanoate (PubChem CID 68807586) has the molecular formula C23H25N3O6S2 and a molecular weight of 503.60 g/mol. Its IUPAC name is ethyl 3-[3-[(3-aminophenyl)sulfonylamino]phenyl]-2-(benzenesulfonamido)propanoate.
| Compound Name | ethyl 3-[3-[(3-aminophenyl)sulfonylamino]phenyl]-2-(benzenesulfonamido)propanoate |
|---|---|
| PubChem CID | 68807586 |
| Molecular Formula | C23H25N3O6S2 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | ethyl 3-[3-[(3-aminophenyl)sulfonylamino]phenyl]-2-(benzenesulfonamido)propanoate |
| SMILES | CCOC(=O)C(Cc1cccc(NS(=O)(=O)c2cccc(N)c2)c1)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H25N3O6S2/c1-2-32-23(27)22(26-33(28,29)20-11-4-3-5-12-20)15-17-8-6-10-19(14-17)25-34(30,31)21-13-7-9-18(24)16-21/h3-14,16,22,25-26H,2,15,24H2,1H3 |
| InChIKey | DAOXDJOOYASMRY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|