C25H25N5O — CID 68826736
1-[(1R)-2,3-dihydro-1H-inden-1-yl]-N-(4-morpholin-4-ylphenyl)pyrazolo[4,3-c]pyridin-6-amine (PubChem CID 68826736) has the molecular formula C25H25N5O and a molecular weight of 411.51 g/mol. Its IUPAC name is 1-[(1R)-2,3-dihydro-1H-inden-1-yl]-N-(4-morpholin-4-ylphenyl)pyrazolo[4,3-c]pyridin-6-amine.
| Compound Name | 1-[(1R)-2,3-dihydro-1H-inden-1-yl]-N-(4-morpholin-4-ylphenyl)pyrazolo[4,3-c]pyridin-6-amine |
|---|---|
| PubChem CID | 68826736 |
| Molecular Formula | C25H25N5O |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 1-[(1R)-2,3-dihydro-1H-inden-1-yl]-N-(4-morpholin-4-ylphenyl)pyrazolo[4,3-c]pyridin-6-amine |
| SMILES | c1ccc2c(c1)CC[C@H]2n1ncc2cnc(Nc3ccc(N4CCOCC4)cc3)cc21 |
| InChI | InChI=1S/C25H25N5O/c1-2-4-22-18(3-1)5-10-23(22)30-24-15-25(26-16-19(24)17-27-30)28-20-6-8-21(9-7-20)29-11-13-31-14-12-29/h1-4,6-9,15-17,23H,5,10-14H2,(H,26,28)/t23-/m1/s1 |
| InChIKey | PFJDBKVZYQGEAZ-HSZRJFAPSA-N |
| XLogP | 4.55 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|