C14H15Cl2NO3S — CID 68828353
4-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylsulfonylbut-3-en-2-one (PubChem CID 68828353) has the molecular formula C14H15Cl2NO3S and a molecular weight of 348.25 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylsulfonylbut-3-en-2-one.
| Compound Name | 4-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylsulfonylbut-3-en-2-one |
|---|---|
| PubChem CID | 68828353 |
| Molecular Formula | C14H15Cl2NO3S |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylsulfonylbut-3-en-2-one |
| SMILES | CC(=O)C(=Cc1ccc(Cl)c(Cl)c1)S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C14H15Cl2NO3S/c1-10(18)14(21(19,20)17-6-2-3-7-17)9-11-4-5-12(15)13(16)8-11/h4-5,8-9H,2-3,6-7H2,1H3 |
| InChIKey | JQNVUPFMRZYNGC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|