C13H15F2NO4 — CID 68832723
2-(2,4-difluoro-N-(2-hydroxyacetyl)anilino)pentanoic acid (PubChem CID 68832723) has the molecular formula C13H15F2NO4 and a molecular weight of 287.26 g/mol. Its IUPAC name is 2-(2,4-difluoro-N-(2-hydroxyacetyl)anilino)pentanoic acid.
| Compound Name | 2-(2,4-difluoro-N-(2-hydroxyacetyl)anilino)pentanoic acid |
|---|---|
| PubChem CID | 68832723 |
| Molecular Formula | C13H15F2NO4 |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2-(2,4-difluoro-N-(2-hydroxyacetyl)anilino)pentanoic acid |
| SMILES | CCCC(C(=O)O)N(C(=O)CO)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H15F2NO4/c1-2-3-11(13(19)20)16(12(18)7-17)10-5-4-8(14)6-9(10)15/h4-6,11,17H,2-3,7H2,1H3,(H,19,20) |
| InChIKey | UTIXFDPUSHGEMH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |