C32H40N4O4 — CID 68839960
[amino(phenyl)methyl] 4-(benzylcarbamoyl)-4-(1-carbamoyl-2-adamantyl)piperidine-1-carboxylate (PubChem CID 68839960) has the molecular formula C32H40N4O4 and a molecular weight of 544.70 g/mol. Its IUPAC name is [amino(phenyl)methyl] 4-(benzylcarbamoyl)-4-(1-carbamoyl-2-adamantyl)piperidine-1-carboxylate.
| Compound Name | [amino(phenyl)methyl] 4-(benzylcarbamoyl)-4-(1-carbamoyl-2-adamantyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68839960 |
| Molecular Formula | C32H40N4O4 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.30 |
| IUPAC Name | [amino(phenyl)methyl] 4-(benzylcarbamoyl)-4-(1-carbamoyl-2-adamantyl)piperidine-1-carboxylate |
| SMILES | NC(=O)C12CC3CC(CC(C3)C1C1(C(=O)NCc3ccccc3)CCN(C(=O)OC(N)c3ccccc3)CC1)C2 |
| InChI | InChI=1S/C32H40N4O4/c33-27(24-9-5-2-6-10-24)40-30(39)36-13-11-31(12-14-36,29(38)35-20-21-7-3-1-4-8-21)26-25-16-22-15-23(17-25)19-32(26,18-22)28(34)37/h1-10,22-23,25-27H,11-20,33H2,(H2,34,37)(H,35,38) |
| InChIKey | TYHBLEZJETVDEK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 127.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|