C16H15FN4O3 — CID 68849298
methyl 3-amino-4-cyano-1-[2-[(4-fluorobenzoyl)amino]ethyl]pyrrole-2-carboxylate (PubChem CID 68849298) has the molecular formula C16H15FN4O3 and a molecular weight of 330.32 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-[2-[(4-fluorobenzoyl)amino]ethyl]pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-[2-[(4-fluorobenzoyl)amino]ethyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 68849298 |
| Molecular Formula | C16H15FN4O3 |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | methyl 3-amino-4-cyano-1-[2-[(4-fluorobenzoyl)amino]ethyl]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1CCNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H15FN4O3/c1-24-16(23)14-13(19)11(8-18)9-21(14)7-6-20-15(22)10-2-4-12(17)5-3-10/h2-5,9H,6-7,19H2,1H3,(H,20,22) |
| InChIKey | PDIAGYCXPYSBDY-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |