C51H53ClO8 — CID 68851982
(2R,3R,4S,5R,6R)-2-[4-chloro-3-[[4-[2-(methoxymethoxy)ethyl]phenyl]methyl]phenoxy]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 68851982) has the molecular formula C51H53ClO8 and a molecular weight of 829.43 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-[4-chloro-3-[[4-[2-(methoxymethoxy)ethyl]phenyl]methyl]phenoxy]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2R,3R,4S,5R,6R)-2-[4-chloro-3-[[4-[2-(methoxymethoxy)ethyl]phenyl]methyl]phenoxy]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 68851982 |
| Molecular Formula | C51H53ClO8 |
| Molecular Weight | 829.43 g/mol |
| Exact Mass | 828.34 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-[4-chloro-3-[[4-[2-(methoxymethoxy)ethyl]phenyl]methyl]phenoxy]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | COCOCCc1ccc(Cc2cc(O[C@H]3O[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)ccc2Cl)cc1 |
| InChI | InChI=1S/C51H53ClO8/c1-53-37-54-29-28-38-22-24-39(25-23-38)30-44-31-45(26-27-46(44)52)59-51-50(58-35-43-20-12-5-13-21-43)49(57-34-42-18-10-4-11-19-42)48(56-33-41-16-8-3-9-17-41)47(60-51)36-55-32-40-14-6-2-7-15-40/h2-27,31,47-51H,28-30,32-37H2,1H3/t47-,48-,49+,50-,51+/m1/s1 |
| InChIKey | JFLJMZJJVBCLIW-PKVCVKGNSA-N |
| XLogP | 10.17 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.43 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|