C26H34ClN5O — CID 68861635
N-[4-[7-chloro-4-[3-(diethylamino)propylamino]quinazolin-2-yl]phenyl]-3-methylbutanamide (PubChem CID 68861635) has the molecular formula C26H34ClN5O and a molecular weight of 468.05 g/mol. Its IUPAC name is N-[4-[7-chloro-4-[3-(diethylamino)propylamino]quinazolin-2-yl]phenyl]-3-methylbutanamide.
| Compound Name | N-[4-[7-chloro-4-[3-(diethylamino)propylamino]quinazolin-2-yl]phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 68861635 |
| Molecular Formula | C26H34ClN5O |
| Molecular Weight | 468.05 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | N-[4-[7-chloro-4-[3-(diethylamino)propylamino]quinazolin-2-yl]phenyl]-3-methylbutanamide |
| SMILES | CCN(CC)CCCNc1nc(-c2ccc(NC(=O)CC(C)C)cc2)nc2cc(Cl)ccc12 |
| InChI | InChI=1S/C26H34ClN5O/c1-5-32(6-2)15-7-14-28-26-22-13-10-20(27)17-23(22)30-25(31-26)19-8-11-21(12-9-19)29-24(33)16-18(3)4/h8-13,17-18H,5-7,14-16H2,1-4H3,(H,29,33)(H,28,30,31) |
| InChIKey | RWROFBBMGBIHHH-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.05 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|