C29H24N4O6 — CID 68865101
[5-[[(3-cyano-4-hydroxybenzoyl)amino]carbamoyl]-4-phenylfuran-3-yl]methyl N-(2-phenylethyl)carbamate (PubChem CID 68865101) has the molecular formula C29H24N4O6 and a molecular weight of 524.53 g/mol. Its IUPAC name is [5-[[(3-cyano-4-hydroxybenzoyl)amino]carbamoyl]-4-phenylfuran-3-yl]methyl N-(2-phenylethyl)carbamate.
| Compound Name | [5-[[(3-cyano-4-hydroxybenzoyl)amino]carbamoyl]-4-phenylfuran-3-yl]methyl N-(2-phenylethyl)carbamate |
|---|---|
| PubChem CID | 68865101 |
| Molecular Formula | C29H24N4O6 |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | [5-[[(3-cyano-4-hydroxybenzoyl)amino]carbamoyl]-4-phenylfuran-3-yl]methyl N-(2-phenylethyl)carbamate |
| SMILES | N#Cc1cc(C(=O)NNC(=O)c2occ(COC(=O)NCCc3ccccc3)c2-c2ccccc2)ccc1O |
| InChI | InChI=1S/C29H24N4O6/c30-16-22-15-21(11-12-24(22)34)27(35)32-33-28(36)26-25(20-9-5-2-6-10-20)23(17-38-26)18-39-29(37)31-14-13-19-7-3-1-4-8-19/h1-12,15,17,34H,13-14,18H2,(H,31,37)(H,32,35)(H,33,36) |
| InChIKey | CIAYYMUNMPMHNR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 153.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|