C25H40F2O5 — CID 68865923
7-[(1R,2R,3R,5S)-2-(3,3-difluorooct-1-enyl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid (PubChem CID 68865923) has the molecular formula C25H40F2O5 and a molecular weight of 458.59 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-2-(3,3-difluorooct-1-enyl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-2-(3,3-difluorooct-1-enyl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 68865923 |
| Molecular Formula | C25H40F2O5 |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-2-(3,3-difluorooct-1-enyl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
| SMILES | CCCCCC(F)(F)C=C[C@@H]1[C@@H](CC=CCCCC(=O)O)[C@@H](O)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C25H40F2O5/c1-2-3-9-15-25(26,27)16-14-20-19(11-6-4-5-7-12-23(29)30)21(28)18-22(20)32-24-13-8-10-17-31-24/h4,6,14,16,19-22,24,28H,2-3,5,7-13,15,17-18H2,1H3,(H,29,30)/t19-,20-,21+,22-,24?/m1/s1 |
| InChIKey | KTZREYQGTWCNJG-NDUFDKTRSA-N |
| XLogP | 5.87 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|