C14H14BrNO4S2 — CID 68926375
[5-(benzenesulfonyl)-4-bromo-3-methylthiophen-2-yl]methyl-methylcarbamic acid (PubChem CID 68926375) has the molecular formula C14H14BrNO4S2 and a molecular weight of 404.31 g/mol. Its IUPAC name is [5-(benzenesulfonyl)-4-bromo-3-methylthiophen-2-yl]methyl-methylcarbamic acid.
| Compound Name | [5-(benzenesulfonyl)-4-bromo-3-methylthiophen-2-yl]methyl-methylcarbamic acid |
|---|---|
| PubChem CID | 68926375 |
| Molecular Formula | C14H14BrNO4S2 |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 402.95 |
| IUPAC Name | [5-(benzenesulfonyl)-4-bromo-3-methylthiophen-2-yl]methyl-methylcarbamic acid |
| SMILES | Cc1c(CN(C)C(=O)O)sc(S(=O)(=O)c2ccccc2)c1Br |
| InChI | InChI=1S/C14H14BrNO4S2/c1-9-11(8-16(2)14(17)18)21-13(12(9)15)22(19,20)10-6-4-3-5-7-10/h3-7H,8H2,1-2H3,(H,17,18) |
| InChIKey | VYYWQSRJTZUNKC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |