C32H26FN3O — CID 68930689
N-cyclopropyl-3-ethenyl-7-fluoro-1-tritylindazole-5-carboxamide (PubChem CID 68930689) has the molecular formula C32H26FN3O and a molecular weight of 487.58 g/mol. Its IUPAC name is N-cyclopropyl-3-ethenyl-7-fluoro-1-tritylindazole-5-carboxamide.
| Compound Name | N-cyclopropyl-3-ethenyl-7-fluoro-1-tritylindazole-5-carboxamide |
|---|---|
| PubChem CID | 68930689 |
| Molecular Formula | C32H26FN3O |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | N-cyclopropyl-3-ethenyl-7-fluoro-1-tritylindazole-5-carboxamide |
| SMILES | C=Cc1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2c(F)cc(C(=O)NC3CC3)cc12 |
| InChI | InChI=1S/C32H26FN3O/c1-2-29-27-20-22(31(37)34-26-18-19-26)21-28(33)30(27)36(35-29)32(23-12-6-3-7-13-23,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h2-17,20-21,26H,1,18-19H2,(H,34,37) |
| InChIKey | WFTYGCUWJKVQNR-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|