C10H11Br — CID 68937024
4-bromotricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 68937024) has the molecular formula C10H11Br and a molecular weight of 211.10 g/mol. Its IUPAC name is 4-bromotricyclo[5.2.1.02,6]deca-3,8-diene.
| Compound Name | 4-bromotricyclo[5.2.1.02,6]deca-3,8-diene |
|---|---|
| PubChem CID | 68937024 |
| Molecular Formula | C10H11Br |
| Molecular Weight | 211.10 g/mol |
| Exact Mass | 210.00 |
| IUPAC Name | 4-bromotricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | BrC1=CC2C3C=CC(C3)C2C1 |
| InChI | InChI=1S/C10H11Br/c11-8-4-9-6-1-2-7(3-6)10(9)5-8/h1-2,4,6-7,9-10H,3,5H2 |
| InChIKey | VZZKMJCFNHHCSJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.10 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|