About 4-bromotricyclo[5.2.1.02,6]deca-3,8-diene
4-bromotricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 68937024) has the molecular formula C10H11Br
and a molecular weight of 211.10 g/mol. Its IUPAC name is 4-bromotricyclo[5.2.1.02,6]deca-3,8-diene.
Molecular Properties
| Compound Name | 4-bromotricyclo[5.2.1.02,6]deca-3,8-diene |
| PubChem CID | 68937024 |
| Molecular Formula | C10H11Br |
| Molecular Weight | 211.10 g/mol |
| Exact Mass | 210.00 |
| IUPAC Name | 4-bromotricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | BrC1=CC2C3C=CC(C3)C2C1 |
| InChI | InChI=1S/C10H11Br/c11-8-4-9-6-1-2-7(3-6)10(9)5-8/h1-2,4,6-7,9-10H,3,5H2 |
| InChIKey | VZZKMJCFNHHCSJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.10 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-bromotricyclo[5.2.1.02,6]deca-3,8-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromotricyclo[5.2.1.02,6]deca-3,8-diene?
The IUPAC name of 4-bromotricyclo[5.2.1.02,6]deca-3,8-diene (CID 68937024) is 4-bromotricyclo[5.2.1.02,6]deca-3,8-diene.
What is the SMILES notation for 4-bromotricyclo[5.2.1.02,6]deca-3,8-diene?
The canonical SMILES for 4-bromotricyclo[5.2.1.02,6]deca-3,8-diene is BrC1=CC2C3C=CC(C3)C2C1.
What is the InChIKey of 4-bromotricyclo[5.2.1.02,6]deca-3,8-diene?
The InChIKey is VZZKMJCFNHHCSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Br/c11-8-4-9-6-1-2-7(3-6)10(9)5-8/h1-2,4,6-7,9-10H,3,5H2.
What are the key properties of 4-bromotricyclo[5.2.1.02,6]deca-3,8-diene?
4-bromotricyclo[5.2.1.02,6]deca-3,8-diene has a molecular weight of 211.10 g/mol, XLogP of 3.11, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromotricyclo[5.2.1.02,6]deca-3,8-diene is sourced from PubChem (CID 68937024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).